Difference between revisions of "IS30-Insertion-Sequences"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7246 == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles: ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o * i...")
(Created page with "Category:metabolite == Metabolite MEVALONATE == * common-name: ** (r)-mevalonate * smiles: ** cc(o)(cco)cc(=o)[o-] * inchi-key: ** kjtlqquupvsxim-zcfiwibfsa-m * molecular-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7246 ==
+
== Metabolite MEVALONATE ==
 
* common-name:
 
* common-name:
** n-acetyl-α-d-galactosamine 1-phosphate
+
** (r)-mevalonate
 
* smiles:
 
* smiles:
** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
+
** cc(o)(cco)cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** fzljpepaypummr-jajwtyfosa-l
+
** kjtlqquupvsxim-zcfiwibfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 299.174
+
** 147.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13760]]
+
* [[1.1.1.34-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13760]]
+
* [[1.1.1.34-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-α-d-galactosamine 1-phosphate}}
+
{{#set: common-name=(r)-mevalonate}}
{{#set: inchi-key=inchikey=fzljpepaypummr-jajwtyfosa-l}}
+
{{#set: inchi-key=inchikey=kjtlqquupvsxim-zcfiwibfsa-m}}
{{#set: molecular-weight=299.174}}
+
{{#set: molecular-weight=147.15}}

Revision as of 14:57, 5 January 2021

Metabolite MEVALONATE

  • common-name:
    • (r)-mevalonate
  • smiles:
    • cc(o)(cco)cc(=o)[o-]
  • inchi-key:
    • kjtlqquupvsxim-zcfiwibfsa-m
  • molecular-weight:
    • 147.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality