Difference between revisions of "IS30-Insertion-Sequences"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7246 == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles: ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o * i...") |
(Created page with "Category:metabolite == Metabolite MEVALONATE == * common-name: ** (r)-mevalonate * smiles: ** cc(o)(cco)cc(=o)[o-] * inchi-key: ** kjtlqquupvsxim-zcfiwibfsa-m * molecular-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MEVALONATE == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-mevalonate |
* smiles: | * smiles: | ||
− | ** cc | + | ** cc(o)(cco)cc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kjtlqquupvsxim-zcfiwibfsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 147.15 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[1.1.1.34-RXN]] |
+ | * [[MEVALONATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.1.1.34-RXN]] |
+ | * [[MEVALONATE-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-mevalonate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kjtlqquupvsxim-zcfiwibfsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.15}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite MEVALONATE
- common-name:
- (r)-mevalonate
- smiles:
- cc(o)(cco)cc(=o)[o-]
- inchi-key:
- kjtlqquupvsxim-zcfiwibfsa-m
- molecular-weight:
- 147.15