Difference between revisions of "1-Linoleoyl-2-acyl-glycerolipids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == * common-name: ** (r)-4'-phosphopantothenoyl-l-cysteine * smiles: ** cc(c)(cop(=o)([o-])[o-])c(o)c(...")
(Created page with "Category:metabolite == Metabolite tRNA-adenine-37 == * common-name: ** an adenine37 in trna == Reaction(s) known to consume the compound == * RXN-14570 == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE ==
+
== Metabolite tRNA-adenine-37 ==
 
* common-name:
 
* common-name:
** (r)-4'-phosphopantothenoyl-l-cysteine
+
** an adenine37 in trna
* smiles:
 
** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
 
* inchi-key:
 
** xqyalqvlcnhcft-cbapkceasa-k
 
* molecular-weight:
 
** 399.332
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[P-PANTOCYSDECARB-RXN]]
+
* [[RXN-14570]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[P-PANTOCYSLIG-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}}
+
{{#set: common-name=an adenine37 in trna}}
{{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}}
 
{{#set: molecular-weight=399.332}}
 

Revision as of 14:57, 5 January 2021

Metabolite tRNA-adenine-37

  • common-name:
    • an adenine37 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality