Difference between revisions of "CPD-7139"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Octadec-2-enoyl-ACPs == * common-name: ** a trans-octadec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9635 *...")
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * smiles: ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Octadec-2-enoyl-ACPs ==
+
== Metabolite COPROPORPHYRINOGEN_III ==
 
* common-name:
 
* common-name:
** a trans-octadec-2-enoyl-[acp]
+
** coproporphyrinogen iii
 +
* smiles:
 +
** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 +
* inchi-key:
 +
** niuvhxtxuxofeb-uhfffaoysa-j
 +
* molecular-weight:
 +
** 656.734
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9635]]
+
* [[HEMN-RXN]]
* [[RXN3O-5293]]
+
* [[RXN-17517]]
 +
* [[RXN0-1461]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9634]]
+
* [[UROGENDECARBOX-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trans-octadec-2-enoyl-[acp]}}
+
{{#set: common-name=coproporphyrinogen iii}}
 +
{{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}}
 +
{{#set: molecular-weight=656.734}}

Revision as of 14:57, 5 January 2021

Metabolite COPROPORPHYRINOGEN_III

  • common-name:
    • coproporphyrinogen iii
  • smiles:
    • cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
  • inchi-key:
    • niuvhxtxuxofeb-uhfffaoysa-j
  • molecular-weight:
    • 656.734

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality