Difference between revisions of "Non-Glucosylated-Glucose-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14594 == * common-name: ** linustatin * smiles: ** cc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** fersmfqb...") |
(Created page with "Category:metabolite == Metabolite CPD-8579 == * common-name: ** a [histone] n6-methyl-l-lysine == Reaction(s) known to consume the compound == == Reaction(s) known to prod...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8579 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [histone] n6-methyl-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [histone] n6-methyl-l-lysine}} |
| − | |||
| − | |||
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-8579
- common-name:
- a [histone] n6-methyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [histone] n6-methyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
