Difference between revisions of "Adenine-34-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXIDIZED-DITHIOTHREITOL == * common-name: ** oxidized dithiothreitol * smiles: ** c1(sscc(o)c(o)1) * inchi-key: ** ypgmowhxeqdbbv-imjsidk...")
(Created page with "Category:metabolite == Metabolite CPD-61 == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] * inchi-key: ** wtiiulqjlzehgz-cvyqjglw...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXIDIZED-DITHIOTHREITOL ==
+
== Metabolite CPD-61 ==
 
* common-name:
 
* common-name:
** oxidized dithiothreitol
+
** (2r,3s)-2,3-dimethylmalate
 
* smiles:
 
* smiles:
** c1(sscc(o)c(o)1)
+
** cc(c(=o)[o-])c(c)(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ypgmowhxeqdbbv-imjsidkusa-n
+
** wtiiulqjlzehgz-cvyqjglwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 152.226
+
** 160.126
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
+
* [[23-DIMETHYLMALATE-LYASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxidized dithiothreitol}}
+
{{#set: common-name=(2r,3s)-2,3-dimethylmalate}}
{{#set: inchi-key=inchikey=ypgmowhxeqdbbv-imjsidkusa-n}}
+
{{#set: inchi-key=inchikey=wtiiulqjlzehgz-cvyqjglwsa-l}}
{{#set: molecular-weight=152.226}}
+
{{#set: molecular-weight=160.126}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-61

  • common-name:
    • (2r,3s)-2,3-dimethylmalate
  • smiles:
    • cc(c(=o)[o-])c(c)(o)c(=o)[o-]
  • inchi-key:
    • wtiiulqjlzehgz-cvyqjglwsa-l
  • molecular-weight:
    • 160.126

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality