Difference between revisions of "CPD-19163"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBITOL == * common-name: ** d-ribitol * smiles: ** c(o)c(o)c(o)c(o)co * inchi-key: ** hebkchpvoiaqta-zxfhetkhsa-n * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11878 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,4-dihydroxyphenylglycol |
* smiles: | * smiles: | ||
− | ** c(o)c(o)c(o)c(o) | + | ** c(o)c(o)c1(c=cc(o)=c(o)c=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mtvwfvdwrvydor-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 170.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10911]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxyphenylglycol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.165}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-11878
- common-name:
- 3,4-dihydroxyphenylglycol
- smiles:
- c(o)c(o)c1(c=cc(o)=c(o)c=1)
- inchi-key:
- mtvwfvdwrvydor-qmmmgpobsa-n
- molecular-weight:
- 170.165