Difference between revisions of "Glycols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7109 == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c * inchi-key: ** lwl...") |
(Created page with "Category:metabolite == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == * common-name: ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ovprppovaxrced-wvzvxsggsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.098 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[KDPGALDOL-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PGLUCONDEHYDRAT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-dehydro-3-deoxy-d-gluconate 6-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ovprppovaxrced-wvzvxsggsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.098}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE
- common-name:
- 2-dehydro-3-deoxy-d-gluconate 6-phosphate
- smiles:
- c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- ovprppovaxrced-wvzvxsggsa-k
- molecular-weight:
- 255.098
