Difference between revisions of "2-HYDROXYPHYTANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FAD == * common-name: ** fad * smiles: ** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=n...")
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FAD ==
+
== Metabolite GLC-D-LACTONE ==
 
* common-name:
 
* common-name:
** fad
+
** d-glucono-1,5-lactone
 
* smiles:
 
* smiles:
** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=nc=nc=23)))o4))=o)([o-])=o)o)5))=c6))
+
** c(o)c1(oc(c(c(c1o)o)o)=o)
 
* inchi-key:
 
* inchi-key:
** imgvnjnccgxbhd-uybvjogssa-k
+
** phoqvhqstubqqk-sqougzdysa-n
 
* molecular-weight:
 
* molecular-weight:
** 782.533
+
** 178.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOA120OR]]
+
* [[GLUCONOLACT-RXN]]
* [[ACOA140OR]]
 
* [[ACOA160OR]]
 
* [[ACOA40OR]]
 
* [[ACOA80OR]]
 
* [[ACOAD1f]]
 
* [[FAD-PYROPHOSPHATASE-RXN]]
 
* [[IVCDH]]
 
* [[MCDH]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
* [[PPCOAOm]]
 
* [[RXN-11695]]
 
* [[RXN-14264]]
 
* [[SUCDHm]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOAD1f]]
 
* [[FAD-PYROPHOSPHATASE-RXN]]
 
* [[FADSYN-RXN]]
 
* [[PPCOAOm]]
 
* [[RXN-11695]]
 
* [[RXN-14264]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fad}}
+
{{#set: common-name=d-glucono-1,5-lactone}}
{{#set: inchi-key=inchikey=imgvnjnccgxbhd-uybvjogssa-k}}
+
{{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}}
{{#set: molecular-weight=782.533}}
+
{{#set: molecular-weight=178.141}}

Revision as of 14:58, 5 January 2021

Metabolite GLC-D-LACTONE

  • common-name:
    • d-glucono-1,5-lactone
  • smiles:
    • c(o)c1(oc(c(c(c1o)o)o)=o)
  • inchi-key:
    • phoqvhqstubqqk-sqougzdysa-n
  • molecular-weight:
    • 178.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality