Difference between revisions of "Trans-3-cis-5-dienoyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-GLUCOSE == * common-name: ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(c...")
(Created page with "Category:metabolite == Metabolite CPD-8630 == * common-name: ** a 5'-diphospho-purine-[mrna] == Reaction(s) known to consume the compound == * MRNA-GUANYLYLTRANSFERASE-R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DTDP-DEOH-DEOXY-GLUCOSE ==
+
== Metabolite CPD-8630 ==
 
* common-name:
 
* common-name:
** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
+
** a 5'-diphospho-purine-[mrna]
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
 
* inchi-key:
 
** psxwnitxwwecny-ucbtuhgzsa-l
 
* molecular-weight:
 
** 544.302
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPDEHYDRHAMEPIM-RXN]]
+
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[RXN-12826]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
 +
* [[RXN-12826]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}}
+
{{#set: common-name=a 5'-diphospho-purine-[mrna]}}
{{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}}
 
{{#set: molecular-weight=544.302}}
 

Revision as of 14:58, 5 January 2021

Metabolite CPD-8630

  • common-name:
    • a 5'-diphospho-purine-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-diphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.