Difference between revisions of "CPD-12676"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine2605 == * common-name: ** uridine2605 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11836 == Reac...") |
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == |
* common-name: | * common-name: | ||
− | ** | + | ** 6-phospho d-glucono-1,5-lactone |
+ | * smiles: | ||
+ | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1) | ||
+ | * inchi-key: | ||
+ | ** ijojivndfqsgab-sqougzdysa-l | ||
+ | * molecular-weight: | ||
+ | ** 256.105 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[6PGLUCONOLACT-RXN]] |
+ | * [[RXN-14819]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[G6PADH]] | ||
+ | * [[G6PADHh]] | ||
+ | * [[G6PBDH]] | ||
+ | * [[G6PBDHh]] | ||
+ | * [[GLU6PDEHYDROG-RXN]] | ||
+ | * [[RXN-14819]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6-phospho d-glucono-1,5-lactone}} |
+ | {{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}} | ||
+ | {{#set: molecular-weight=256.105}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite D-6-P-GLUCONO-DELTA-LACTONE
- common-name:
- 6-phospho d-glucono-1,5-lactone
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
- inchi-key:
- ijojivndfqsgab-sqougzdysa-l
- molecular-weight:
- 256.105