Difference between revisions of "CPD-7616"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NITRIC-OXIDE == * common-name: ** nitric oxide * smiles: ** n=o * inchi-key: ** mwuxshhqayifbg-uhfffaoysa-n * molecular-weight: ** 30.006...") |
(Created page with "Category:metabolite == Metabolite CPD-3061 == * common-name: ** (2s)-liquiritigenin * smiles: ** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o) * inchi-key: ** furuxtvzlhccn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3061 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-liquiritigenin |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** furuxtvzlhccna-aweznqclsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.257 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-3221]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s)-liquiritigenin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=furuxtvzlhccna-aweznqclsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.257}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-3061
- common-name:
- (2s)-liquiritigenin
- smiles:
- c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
- inchi-key:
- furuxtvzlhccna-aweznqclsa-n
- molecular-weight:
- 256.257
