Difference between revisions of "METHYL-GLYOXAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc(ccop([o-])(=o)[o-])=1) * inchi-key: ** ocymerzcm...") |
(Created page with "Category:metabolite == Metabolite CPDQT-30 == * common-name: ** 9-(methylthio)-2-oxononanoate * smiles: ** cscccccccc(=o)c([o-])=o * inchi-key: ** mjgxiouqxyxglp-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-30 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9-(methylthio)-2-oxononanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cscccccccc(=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mjgxiouqxyxglp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 217.302 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXNQT-4174]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9-(methylthio)-2-oxononanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mjgxiouqxyxglp-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.302}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPDQT-30
- common-name:
- 9-(methylthio)-2-oxononanoate
- smiles:
- cscccccccc(=o)c([o-])=o
- inchi-key:
- mjgxiouqxyxglp-uhfffaoysa-m
- molecular-weight:
- 217.302
