Difference between revisions of "CPD-8773"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE == * common-name: ** 5-amino-6-(d-ribitylamino)uracil * smiles: ** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-5-methylcytosine1962 == * common-name: ** a 5-methylcytosine1962 in 23s rrna == Reaction(s) known to consume the compound == ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE ==
+
== Metabolite 23S-rRNA-5-methylcytosine1962 ==
 
* common-name:
 
* common-name:
** 5-amino-6-(d-ribitylamino)uracil
+
** a 5-methylcytosine1962 in 23s rrna
* smiles:
 
** c(nc1(nc(nc(=o)c(n)=1)=o))c(o)c(o)c(o)co
 
* inchi-key:
 
** xkqzixvjvupore-rpdrrwsusa-n
 
* molecular-weight:
 
** 276.249
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LUMAZINESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RIBOFLAVIN-SYN-RXN]]
+
* [[RXN-11602]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-6-(d-ribitylamino)uracil}}
+
{{#set: common-name=a 5-methylcytosine1962 in 23s rrna}}
{{#set: inchi-key=inchikey=xkqzixvjvupore-rpdrrwsusa-n}}
 
{{#set: molecular-weight=276.249}}
 

Revision as of 14:59, 5 January 2021

Metabolite 23S-rRNA-5-methylcytosine1962

  • common-name:
    • a 5-methylcytosine1962 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality