Difference between revisions of "D-SEDOHEPTULOSE-1-7-P2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...") |
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == |
* common-name: | * common-name: | ||
| − | ** | + | ** vitamin k 2,3-epoxide |
* smiles: | * smiles: | ||
| − | ** cc(c) | + | ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kutxfbihpwidjq-hbdfacptsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 466.703 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.4.1-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.4.1-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=vitamin k 2,3-epoxide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=466.703}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ
- common-name:
- vitamin k 2,3-epoxide
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
- inchi-key:
- kutxfbihpwidjq-hbdfacptsa-n
- molecular-weight:
- 466.703
