Difference between revisions of "MANNOSE-6P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(oc...")
(Created page with "Category:metabolite == Metabolite ACET == * common-name: ** acetate * smiles: ** cc([o-])=o * inchi-key: ** qtbsbxvteameqo-uhfffaoysa-m * molecular-weight: ** 59.044 == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8291 ==
+
== Metabolite ACET ==
 
* common-name:
 
* common-name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** acetate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o
+
** cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** mwrbnpkjoowzpw-nyvomtagsa-n
+
** qtbsbxvteameqo-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 744.043
+
** 59.044
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15036]]
+
* [[ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.]]
* [[RXN-15067]]
+
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
 +
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
 +
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[ACETYLORNDEACET-RXN]]
 +
* [[ACSERLY-RXN]]
 +
* [[SULFOCYS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15036]]
+
* [[3.1.1.47-RXN]]
 +
* [[3.1.1.56-RXN]]
 +
* [[3.1.1.69-RXN]]
 +
* [[3.5.1.98-RXN]]
 +
* [[ACETYLCHOLINESTERASE-RXN]]
 +
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[ACETYLORNDEACET-RXN]]
 +
* [[ACHMSSELCYSL]]
 +
* [[ACHMSSELCYSLh]]
 +
* [[ACSERLY-RXN]]
 +
* [[AODAA]]
 +
* [[ARYLESTERASE-RXN]]
 +
* [[CHITIN-DEACETYLASE-RXN]]
 +
* [[RXN-12726]]
 +
* [[RXN-13684]]
 +
* [[RXN-14728]]
 +
* [[RXN-7933]]
 +
* [[RXN66-3]]
 +
* [[SULFOCYS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: common-name=acetate}}
{{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}}
+
{{#set: inchi-key=inchikey=qtbsbxvteameqo-uhfffaoysa-m}}
{{#set: molecular-weight=744.043}}
+
{{#set: molecular-weight=59.044}}

Revision as of 14:59, 5 January 2021