Difference between revisions of "Cerebrosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-RADYL-2-ACETYL-SN-GLYCERO-3-PHOSPHOLIP == * smiles: ** cc(=o)oc(co[r1])cop(=o)([o-])o[r2] * common-name: ** 1-organyl-2-acetyl-sn-glyce...")
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-RADYL-2-ACETYL-SN-GLYCERO-3-PHOSPHOLIP ==
+
== Metabolite CPD-11408 ==
 +
* common-name:
 +
** triiodothyronine sulfate
 
* smiles:
 
* smiles:
** cc(=o)oc(co[r1])cop(=o)([o-])o[r2]
+
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
* common-name:
+
* inchi-key:
** 1-organyl-2-acetyl-sn-glycero-3-phospholipid
+
** xbqyqxvjbndcgy-lbprgkrzsa-m
 +
* molecular-weight:
 +
** 730.028
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.149-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.149-RXN]]
+
* [[RXN-10615]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-organyl-2-acetyl-sn-glycero-3-phospholipid}}
+
{{#set: common-name=triiodothyronine sulfate}}
 +
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
 +
{{#set: molecular-weight=730.028}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-11408

  • common-name:
    • triiodothyronine sulfate
  • smiles:
    • c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
  • inchi-key:
    • xbqyqxvjbndcgy-lbprgkrzsa-m
  • molecular-weight:
    • 730.028

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality