Difference between revisions of "Heparan-sulfate-D-GlcNS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...")
(Created page with "Category:metabolite == Metabolite Protein-L-Asparagine == * common-name: ** a [protein]-l-asparagine == Reaction(s) known to consume the compound == * 2.4.1.119-RXN *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10814 ==
+
== Metabolite Protein-L-Asparagine ==
 
* common-name:
 
* common-name:
** glycyl-l-proline
+
** a [protein]-l-asparagine
* smiles:
 
** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
 
* inchi-key:
 
** kznqnbzmbzjqjo-yfkpbyrvsa-n
 
* molecular-weight:
 
** 172.183
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6988]]
+
* [[2.4.1.119-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[RXN-16761]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.94-RXN]]
 +
* [[RXN-16761]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycyl-l-proline}}
+
{{#set: common-name=a [protein]-l-asparagine}}
{{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}}
 
{{#set: molecular-weight=172.183}}
 

Revision as of 14:59, 5 January 2021

Metabolite Protein-L-Asparagine

  • common-name:
    • a [protein]-l-asparagine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-asparagine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.