Difference between revisions of "Alkyl-acetyl-glycero-phosphocholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CDP-2-3-4-Saturated-Diacylglycerols == * common-name: ** a cdp-2,3,4-saturated-diacylglycerol == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite CPD-14423 == * common-name: ** 3-oxo-docosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CDP-2-3-4-Saturated-Diacylglycerols ==
+
== Metabolite CPD-14423 ==
 
* common-name:
 
* common-name:
** a cdp-2,3,4-saturated-diacylglycerol
+
** 3-oxo-docosapentaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** slykkqsprfjdaf-hvganwhpsa-j
 +
* molecular-weight:
 +
** 1089.98
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13443]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5515]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cdp-2,3,4-saturated-diacylglycerol}}
+
{{#set: common-name=3-oxo-docosapentaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=slykkqsprfjdaf-hvganwhpsa-j}}
 +
{{#set: molecular-weight=1089.98}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-14423

  • common-name:
    • 3-oxo-docosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • slykkqsprfjdaf-hvganwhpsa-j
  • molecular-weight:
    • 1089.98

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality