Difference between revisions of "Sulfamates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNAPhe-Containing-4-demethylwyosine-37 == * common-name: ** 4-demethylwyosine37 in trnaphe == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CPD-19492 == * common-name: ** 3-ethyl-2-oxosuccinate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])=o * inchi-key: ** ouglpihdpbrsid-uhfffaoysa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNAPhe-Containing-4-demethylwyosine-37 ==
+
== Metabolite CPD-19492 ==
 
* common-name:
 
* common-name:
** 4-demethylwyosine37 in trnaphe
+
** 3-ethyl-2-oxosuccinate
 +
* smiles:
 +
** ccc(c([o-])=o)c(c(=o)[o-])=o
 +
* inchi-key:
 +
** ouglpihdpbrsid-uhfffaoysa-l
 +
* molecular-weight:
 +
** 158.11
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14518]]
+
* [[RXN-18210]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-demethylwyosine37 in trnaphe}}
+
{{#set: common-name=3-ethyl-2-oxosuccinate}}
 +
{{#set: inchi-key=inchikey=ouglpihdpbrsid-uhfffaoysa-l}}
 +
{{#set: molecular-weight=158.11}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-19492

  • common-name:
    • 3-ethyl-2-oxosuccinate
  • smiles:
    • ccc(c([o-])=o)c(c(=o)[o-])=o
  • inchi-key:
    • ouglpihdpbrsid-uhfffaoysa-l
  • molecular-weight:
    • 158.11

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality