Difference between revisions of "DIHYDRO-DIOH-BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRO-DIOH-BENZOATE == * common-name: ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate * smiles: ** c([o-])(=o)c1(=cc=cc(c1o)o) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite ARACHIDIC_ACID == * common-name: ** arachidate * smiles: ** cccccccccccccccccccc(=o)[o-] * inchi-key: ** vkobvwxkncxxde-uhfffaoysa-m * mo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ARACHIDIC_ACID == |
* common-name: | * common-name: | ||
− | ** | + | ** arachidate |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccccccccccccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vkobvwxkncxxde-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 311.527 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9629]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=arachidate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vkobvwxkncxxde-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=311.527}} |
Revision as of 15:00, 5 January 2021
Contents
Metabolite ARACHIDIC_ACID
- common-name:
- arachidate
- smiles:
- cccccccccccccccccccc(=o)[o-]
- inchi-key:
- vkobvwxkncxxde-uhfffaoysa-m
- molecular-weight:
- 311.527