Difference between revisions of "CPD0-2354"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11522 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc=cc(scc...")
(Created page with "Category:metabolite == Metabolite Pre-tRNA-3-prime-half-molecules == * common-name: ** a 3'-half-trna molecule with a 5'-oh end == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11522 ==
+
== Metabolite Pre-tRNA-3-prime-half-molecules ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
+
** a 3'-half-trna molecule with a 5'-oh end
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** ieeneqseowxdqk-dioafzbusa-j
 
* molecular-weight:
 
** 1009.851
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10704]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10706]]
+
* [[3.1.27.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa}}
+
{{#set: common-name=a 3'-half-trna molecule with a 5'-oh end}}
{{#set: inchi-key=inchikey=ieeneqseowxdqk-dioafzbusa-j}}
 
{{#set: molecular-weight=1009.851}}
 

Revision as of 15:00, 5 January 2021

Metabolite Pre-tRNA-3-prime-half-molecules

  • common-name:
    • a 3'-half-trna molecule with a 5'-oh end

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality