Difference between revisions of "CPD-19172"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_RIBOSE == * common-name: ** 1-(β-d ribofuranosyl)nicotinamide * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)...")
(Created page with "Category:metabolite == Metabolite CPD-12677 == * common-name: ** 5-chloro-5-deoxyribose 1-phosphate * smiles: ** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1) * inchi-key: ** dgv...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NICOTINAMIDE_RIBOSE ==
+
== Metabolite CPD-12677 ==
 
* common-name:
 
* common-name:
** 1-(β-d ribofuranosyl)nicotinamide
+
** 5-chloro-5-deoxyribose 1-phosphate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
+
** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
 
* inchi-key:
 
* inchi-key:
** jlebzpbdrkpwtd-turqnecasa-o
+
** dgviesznpvjdpq-soofdhnksa-l
 
* molecular-weight:
 
* molecular-weight:
** 255.25
+
** 246.541
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5841]]
+
* [[RXN-11715]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}}
+
{{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}}
{{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}}
+
{{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}}
{{#set: molecular-weight=255.25}}
+
{{#set: molecular-weight=246.541}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-12677

  • common-name:
    • 5-chloro-5-deoxyribose 1-phosphate
  • smiles:
    • c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
  • inchi-key:
    • dgviesznpvjdpq-soofdhnksa-l
  • molecular-weight:
    • 246.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality