Difference between revisions of "PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite trans-delta2-lignoceroyl-ACPs == * common-name: ** a trans-tetracos-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN...") |
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_RIBOSE == * common-name: ** 1-(β-d ribofuranosyl)nicotinamide * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NICOTINAMIDE_RIBOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-(β-d ribofuranosyl)nicotinamide |
| + | * smiles: | ||
| + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) | ||
| + | * inchi-key: | ||
| + | ** jlebzpbdrkpwtd-turqnecasa-o | ||
| + | * molecular-weight: | ||
| + | ** 255.25 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-5841]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}} |
| + | {{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}} | ||
| + | {{#set: molecular-weight=255.25}} | ||
Revision as of 15:00, 5 January 2021
Contents
Metabolite NICOTINAMIDE_RIBOSE
- common-name:
- 1-(β-d ribofuranosyl)nicotinamide
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- jlebzpbdrkpwtd-turqnecasa-o
- molecular-weight:
- 255.25
