Difference between revisions of "CPD-3943"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYLCHOLINE == * common-name: ** acetylcholine * smiles: ** cc(=o)occ[n+](c)(c)c * inchi-key: ** oipilfwxsmykgl-uhfffaoysa-n * molecula...")
(Created page with "Category:metabolite == Metabolite CPD-8081 == * common-name: ** 1-18:3-2-18:3-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYLCHOLINE ==
+
== Metabolite CPD-8081 ==
 
* common-name:
 
* common-name:
** acetylcholine
+
** 1-18:3-2-18:3-digalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cc(=o)occ[n+](c)(c)c
+
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
 
* inchi-key:
 
* inchi-key:
** oipilfwxsmykgl-uhfffaoysa-n
+
** kdyapqvyjxuqny-ncuixijtsa-n
 
* molecular-weight:
 
* molecular-weight:
** 146.209
+
** 937.216
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLCHOLINESTERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8311]]
 +
* [[RXN-8314]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acetylcholine}}
+
{{#set: common-name=1-18:3-2-18:3-digalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=oipilfwxsmykgl-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=kdyapqvyjxuqny-ncuixijtsa-n}}
{{#set: molecular-weight=146.209}}
+
{{#set: molecular-weight=937.216}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-8081

  • common-name:
    • 1-18:3-2-18:3-digalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
  • inchi-key:
    • kdyapqvyjxuqny-ncuixijtsa-n
  • molecular-weight:
    • 937.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality