Difference between revisions of "SJ11118"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...")
(Created page with "Category:gene == Gene SJ15636 == * transcription-direction: ** negative * right-end-position: ** 32618 * left-end-position: ** 27304 * centisome-position: ** 9.314447...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite GLN ==
+
== Gene SJ15636 ==
−
* common-name:
+
* transcription-direction:
−
** l-glutamine
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(=o)(n)ccc([n+])c([o-])=o
+
** 32618
−
* inchi-key:
+
* left-end-position:
−
** zdxpyrjpndtmrx-vkhmyheasa-n
+
** 27304
−
* molecular-weight:
+
* centisome-position:
−
** 146.146
+
** 9.314447   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
−
* [[2.6.1.64-RXN]]
+
== Reaction(s) associated ==
−
* [[6.3.5.6-RXN]]
+
* [[PEROXID-RXN]]
−
* [[6.3.5.7-RXN]]
+
** Category: [[annotation]]
−
* [[ANTHRANSYN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ASNSYNB-RXN]]
+
* [[RXN-14240]]
−
* [[CARBPSYN-RXN]]
+
** Category: [[annotation]]
−
* [[CTPSYN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[FGAMSYN-RXN]]
+
* [[RXN-15288]]
−
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
+
** Category: [[annotation]]
−
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GLUTAMATESYN-RXN]]
+
* [[RXN-17352]]
−
* [[GLUTAMIDOTRANS-RXN]]
+
** Category: [[annotation]]
−
* [[GLUTAMIN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
+
* [[RXN-8635]]
−
* [[GMP-SYN-GLUT-RXN]]
+
** Category: [[annotation]]
−
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[NAD-SYNTH-GLN-RXN]]
+
== Pathway(s) associated ==
−
* [[PABASYN-RXN]]
+
* [[PWY-7214]]
−
* [[PRPPAMIDOTRANS-RXN]]
+
** '''1''' reactions found over '''2''' reactions in the full pathway
−
* [[RXN-11322]]
+
* [[PWY-7445]]
−
* [[biomass_rxn]]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
−
</div>
+
* [[PWY-5466]]
−
== Reaction(s) known to produce the compound ==
+
** '''2''' reactions found over '''10''' reactions in the full pathway
−
* [[2.6.1.64-RXN]]
+
* [[PWY-6824]]
−
* [[ANTHRANSYN-RXN]]
+
** '''2''' reactions found over '''10''' reactions in the full pathway
−
* [[GLUTAMINESYN-RXN]]
+
* [[PWY-5469]]
−
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
** '''2''' reactions found over '''8''' reactions in the full pathway
−
* [[PABASYN-RXN]]
+
* [[PWY-5461]]
−
* [[PRPPAMIDOTRANS-RXN]]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
−
* [[RXN0-6976]]
+
{{#set: transcription-direction=negative}}
−
* [[RXN0-6983]]
+
{{#set: right-end-position=32618}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: left-end-position=27304}}
−
{{#set: common-name=l-glutamine}}
+
{{#set: centisome-position=9.314447    }}
−
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
{{#set: molecular-weight=146.146}}
+
{{#set: nb reaction associated=5}}
 +
{{#set: nb pathway associated=6}}

Revision as of 15:24, 5 January 2021

Gene SJ15636

  • transcription-direction:
    • negative
  • right-end-position:
    • 32618
  • left-end-position:
    • 27304
  • centisome-position:
    • 9.314447

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7214
    • 1 reactions found over 2 reactions in the full pathway
  • PWY-7445
    • 1 reactions found over 4 reactions in the full pathway
  • PWY-5466
    • 2 reactions found over 10 reactions in the full pathway
  • PWY-6824
    • 2 reactions found over 10 reactions in the full pathway
  • PWY-5469
    • 2 reactions found over 8 reactions in the full pathway
  • PWY-5461
    • 1 reactions found over 1 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11118&oldid=71467"