Difference between revisions of "CARBAMYUL-L-ASPARTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-SULFINYL-PYRUVATE == * common-name: ** 3-sulfinopyruvate * smiles: ** c(s([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** jxylqemxcaamol-uhfffao...") |
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Dimetgua-26-MeGua27 == * common-name: ** an n2-dimethylguanine26/n2-methylguanine27 == Reaction(s) known to consume th...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Containing-N2-Dimetgua-26-MeGua27 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n2-dimethylguanine26/n2-methylguanine27 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12381]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12380]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n2-dimethylguanine26/n2-methylguanine27}} |
| − | |||
| − | |||
Revision as of 15:24, 5 January 2021
Contents
Metabolite tRNA-Containing-N2-Dimetgua-26-MeGua27
- common-name:
- an n2-dimethylguanine26/n2-methylguanine27
