Difference between revisions of "TRNAPhe-Containing-N1-Methylguanine-37"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNAPhe-Containing-N1-Methylguanine-37 == * common-name: ** an n1-methylguanine37 in trnaphe == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite UDP-L-RHAMNOSE == * common-name: ** udp-β-l-rhamnose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNAPhe-Containing-N1-Methylguanine-37 ==
+
== Metabolite UDP-L-RHAMNOSE ==
 
* common-name:
 
* common-name:
** an n1-methylguanine37 in trnaphe
+
** udp-β-l-rhamnose
 +
* smiles:
 +
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
 +
* inchi-key:
 +
** drdcjeizvlvwnc-slbwpepysa-l
 +
* molecular-weight:
 +
** 548.29
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14517]]
+
* [[RXN-10740]]
 +
* [[RXN-5482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n1-methylguanine37 in trnaphe}}
+
{{#set: common-name=udp-β-l-rhamnose}}
 +
{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}
 +
{{#set: molecular-weight=548.29}}

Revision as of 15:25, 5 January 2021

Metabolite UDP-L-RHAMNOSE

  • common-name:
    • udp-β-l-rhamnose
  • smiles:
    • cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
  • inchi-key:
    • drdcjeizvlvwnc-slbwpepysa-l
  • molecular-weight:
    • 548.29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality