Difference between revisions of "CPD-17375"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13378 == * common-name: ** xllg xyloglucan oligosaccharide * smiles: ** c9(c(c(c(c(occ8(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(...")
(Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13378 ==
+
== Metabolite CPD-24185 ==
* common-name:
 
** xllg xyloglucan oligosaccharide
 
* smiles:
 
** c9(c(c(c(c(occ8(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc6(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)oc5(c(c(c(c(o5)co)o)o)o)))6)oc7(c(o)c(o)c(o)oc(co)7))))c(o)c(o)c(o)8))o9)o)o)o)
 
* inchi-key:
 
** gschigxdtvyeem-migiythbsa-n
 
* molecular-weight:
 
** 1387.215
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12400]]
+
* [[RXN-22198]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-22206]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xllg xyloglucan oligosaccharide}}
 
{{#set: inchi-key=inchikey=gschigxdtvyeem-migiythbsa-n}}
 
{{#set: molecular-weight=1387.215}}
 

Revision as of 15:25, 5 January 2021

Metabolite CPD-24185

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality