Difference between revisions of "CELLULOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite TRIPEPTIDES == * common-name: ** a tripeptide == Reaction(s) known to consume the compound == * 3.4.11.4-RXN == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-DIPHOSPHATE ==
+
== Metabolite TRIPEPTIDES ==
 
* common-name:
 
* common-name:
** all-trans-octaprenyl diphosphate
+
** a tripeptide
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
* inchi-key:
 
** ikkldissulffqo-djmiluhssa-k
 
* molecular-weight:
 
** 719.897
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+
* [[3.4.11.4-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.14.10-RXN]]
 +
* [[3.4.14.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-octaprenyl diphosphate}}
+
{{#set: common-name=a tripeptide}}
{{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}}
 
{{#set: molecular-weight=719.897}}
 

Revision as of 15:25, 5 January 2021

Metabolite TRIPEPTIDES

  • common-name:
    • a tripeptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality