Difference between revisions of "Benzosemiquinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D7-tetradecenoyl-ACPs == * common-name: ** a trans-δ3-cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite CPD-19171 == * common-name: ** (s)-3-hydroxy-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Trans-D3-cis-D7-tetradecenoyl-ACPs ==
+
== Metabolite CPD-19171 ==
 
* common-name:
 
* common-name:
** a trans-δ3-cis-δ7-tetradecenoyl-[acp]
+
** (s)-3-hydroxy-(9z)-octadecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** lhayytcfpmuqnr-dfxypyghsa-j
 +
* molecular-weight:
 +
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10657]]
+
* [[RXN-17777]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10656]]
+
* [[RXN-17776]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trans-δ3-cis-δ7-tetradecenoyl-[acp]}}
+
{{#set: common-name=(s)-3-hydroxy-(9z)-octadecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=lhayytcfpmuqnr-dfxypyghsa-j}}
 +
{{#set: molecular-weight=1043.952}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-19171

  • common-name:
    • (s)-3-hydroxy-(9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lhayytcfpmuqnr-dfxypyghsa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality