Difference between revisions of "Ubiquitin-carrier-protein-E2-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Oxidized == * common-name: ** an oxidized c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RX...") |
(Created page with "Category:metabolite == Metabolite CPD-13403 == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** hjcmdxdypoufdy-whfbia...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13403 == |
* common-name: | * common-name: | ||
− | ** | + | ** l-alanyl-l-glutamine |
+ | * smiles: | ||
+ | ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n | ||
+ | * inchi-key: | ||
+ | ** hjcmdxdypoufdy-whfbiakzsa-n | ||
+ | * molecular-weight: | ||
+ | ** 217.224 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-6976]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-glutamine}} |
+ | {{#set: inchi-key=inchikey=hjcmdxdypoufdy-whfbiakzsa-n}} | ||
+ | {{#set: molecular-weight=217.224}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-13403
- common-name:
- l-alanyl-l-glutamine
- smiles:
- cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n
- inchi-key:
- hjcmdxdypoufdy-whfbiakzsa-n
- molecular-weight:
- 217.224