Difference between revisions of "5-DIPHOSPHO-1D-MYO-INOSITOL-12346P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * smiles: ** cc1(c(=ccop([o-])(=o)[o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13575 == |
* common-name: | * common-name: | ||
− | ** (2r, | + | ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pqmcqnovnfnpfj-hyimlasbsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 264.169 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-12611]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[THIAZOLSYN2-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=(2r, | + | {{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=264.169}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-13575
- common-name:
- 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
- smiles:
- cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
- inchi-key:
- pqmcqnovnfnpfj-hyimlasbsa-k
- molecular-weight:
- 264.169
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.