Difference between revisions of "5-DIPHOSPHO-1D-MYO-INOSITOL-12346P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...")
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * smiles: ** cc1(c(=ccop([o-])(=o)[o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE ==
+
== Metabolite CPD-13575 ==
 
* common-name:
 
* common-name:
** (2r,3s)-3-isopropylmalate
+
** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
 
* smiles:
 
* smiles:
** cc(c)c(c([o-])=o)c(c([o-])=o)o
+
** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
 
* inchi-key:
 
* inchi-key:
** rnqhmtfbussbjq-crclsjgqsa-l
+
** pqmcqnovnfnpfj-hyimlasbsa-k
 
* molecular-weight:
 
* molecular-weight:
** 174.153
+
** 264.169
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
* [[RXN-12611]]
* [[IMDH]]
 
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 
* [[RXN-13158]]
 
* [[RXN-13163]]
 
* [[RXN-8991]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
* [[THIAZOLSYN2-RXN]]
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 
* [[RXN-13163]]
 
* [[RXN-8991]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s)-3-isopropylmalate}}
+
{{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}}
{{#set: inchi-key=inchikey=rnqhmtfbussbjq-crclsjgqsa-l}}
+
{{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}}
{{#set: molecular-weight=174.153}}
+
{{#set: molecular-weight=264.169}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-13575

  • common-name:
    • 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
  • smiles:
    • cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
  • inchi-key:
    • pqmcqnovnfnpfj-hyimlasbsa-k
  • molecular-weight:
    • 264.169

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.