Difference between revisions of "Cysteine-Desulfurase-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7953 == * common-name: ** torulene * smiles: ** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite Methylated-DNA-Bases == * common-name: ** a methylated nucleobase within dna == Reaction(s) known to consume the compound == * RXN-1235...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Methylated-DNA-Bases == |
* common-name: | * common-name: | ||
− | ** | + | ** a methylated nucleobase within dna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12353]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a methylated nucleobase within dna}} |
− | |||
− |
Revision as of 15:26, 5 January 2021
Contents
Metabolite Methylated-DNA-Bases
- common-name:
- a methylated nucleobase within dna