Difference between revisions of "L-Methionylaminoacyl-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-27 == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4)) * inchi...")
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD66-27 ==
+
== Metabolite DIHYDRONEOPTERIN-P ==
 
* common-name:
 
* common-name:
** pregn-5-ene-3,20-dione-17-ol
+
** 7,8-dihydroneopterin 3'-phosphate
 
* smiles:
 
* smiles:
** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
+
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
 
* inchi-key:
 
* inchi-key:
** rcfjdvcranozel-uhfffaoysa-n
+
** plsqmgzyogsoce-xinawcovsa-l
 
* molecular-weight:
 
* molecular-weight:
** 330.466
+
** 333.197
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-350]]
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-350]]
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: common-name=7,8-dihydroneopterin 3'-phosphate}}
{{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}}
{{#set: molecular-weight=330.466}}
+
{{#set: molecular-weight=333.197}}

Revision as of 15:26, 5 January 2021

Metabolite DIHYDRONEOPTERIN-P

  • common-name:
    • 7,8-dihydroneopterin 3'-phosphate
  • smiles:
    • c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
  • inchi-key:
    • plsqmgzyogsoce-xinawcovsa-l
  • molecular-weight:
    • 333.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality