Difference between revisions of "THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9955 == * common-name: ** ubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c...")
(Created page with "Category:metabolite == Metabolite CARDIOLIPIN == * common-name: ** a cardiolipin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9955 ==
+
== Metabolite CARDIOLIPIN ==
 
* common-name:
 
* common-name:
** ubiquinol-7
+
** a cardiolipin
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
** pfiusppkanbdhq-rjyqsxaysa-n
 
* molecular-weight:
 
** 661.019
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9229]]
+
* [[CARDIOLIPSYN-RXN]]
 +
* [[RXN-8141]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-7}}
+
{{#set: common-name=a cardiolipin}}
{{#set: inchi-key=inchikey=pfiusppkanbdhq-rjyqsxaysa-n}}
 
{{#set: molecular-weight=661.019}}
 

Revision as of 15:26, 5 January 2021

Metabolite CARDIOLIPIN

  • common-name:
    • a cardiolipin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality