Difference between revisions of "METHYLARSONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-458 == * common-name: ** galactinol * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o * inchi-key: ** vcwmrqdbpzkxkg-xidcd...") |
(Created page with "Category:metabolite == Metabolite BETA-L-ARABINOSE == * common-name: ** β-l-arabinopyranose * smiles: ** c1(c(c(c(c(o1)o)o)o)o) * inchi-key: ** srbfzhdqgsbbor-klvwxmo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BETA-L-ARABINOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-l-arabinopyranose |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(c(c(c(o1)o)o)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** srbfzhdqgsbbor-klvwxmoxsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BETA-L-ARABINOSIDASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-l-arabinopyranose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=srbfzhdqgsbbor-klvwxmoxsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite BETA-L-ARABINOSE
- common-name:
- β-l-arabinopyranose
- smiles:
- c1(c(c(c(c(o1)o)o)o)o)
- inchi-key:
- srbfzhdqgsbbor-klvwxmoxsa-n
- molecular-weight:
- 150.131
