Difference between revisions of "PHOSPHORIBOSYL-ATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o...")
(Created page with "Category:metabolite == Metabolite Gal-Gal-Xyl-Proteins == * common-name: ** a [protein]-3-o-(β-d-galactosyl-(1→3)-β-d-galactosyl-(1→4)-β-d-xylosyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1107 ==
+
== Metabolite Gal-Gal-Xyl-Proteins ==
 
* common-name:
 
* common-name:
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** a [protein]-3-o-(β-d-galactosyl-(1→3)-β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine
* smiles:
 
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
** ctpqaxvnygzuaj-kxxvrosksa-d
 
* molecular-weight:
 
** 569.977
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10963]]
 
* [[RXN-13197]]
 
* [[RXN-7163]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.134-RXN]]
+
* [[2.4.1.134-RXN]]
* [[2.7.1.140-RXN]]
 
* [[RXN-10963]]
 
* [[RXN-13197]]
 
* [[RXN-7162]]
 
* [[RXN-7184]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
+
{{#set: common-name=a [protein]-3-o-(β-d-galactosyl-(1→3)-β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
 
{{#set: molecular-weight=569.977}}
 

Revision as of 15:27, 5 January 2021

Metabolite Gal-Gal-Xyl-Proteins

  • common-name:
    • a [protein]-3-o-(β-d-galactosyl-(1→3)-β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-(β-d-galactosyl-(1→3)-β-d-galactosyl-(1→4)-β-d-xylosyl)-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.