Difference between revisions of "Pro-tRNA-2-O-MeCytidine4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite HMP == * common-name: ** 4-amino-2-methyl-5-pyrimidinemethanol * smiles: ** cc1(n=c(c(=cn=1)co)n) * inchi-key: ** vutbelpredjddh-uhfffaoy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-amino-2-methyl-5-pyrimidinemethanol |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc1(n=c(c(=cn=1)co)n) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vutbelpredjddh-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 139.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[OHMETPYRKIN-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12613]] |
| + | * [[THIAMINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-amino-2-methyl-5-pyrimidinemethanol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vutbelpredjddh-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=139.157}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite HMP
- common-name:
- 4-amino-2-methyl-5-pyrimidinemethanol
- smiles:
- cc1(n=c(c(=cn=1)co)n)
- inchi-key:
- vutbelpredjddh-uhfffaoysa-n
- molecular-weight:
- 139.157
