Difference between revisions of "CPD-13684"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite cis-5-enoyl-CoA == * common-name: ** a (5z)-alkan-5-enoyl-coa == Reaction(s) known to consume the compound == * RXN-12518 == Reaction...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite cis-5-enoyl-CoA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (5z)-alkan-5-enoyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-12518]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (5z)-alkan-5-enoyl-coa}} |
| − | |||
| − | |||
Revision as of 15:27, 5 January 2021
Contents
Metabolite cis-5-enoyl-CoA
- common-name:
- a (5z)-alkan-5-enoyl-coa
