Difference between revisions of "Cis-5-enoyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15237 == * common-name: ** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-phosphate == Reaction(s) known to consume the compound =...") |
(Created page with "Category:metabolite == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == * common-name: ** n-succinyl-l,l-2,6-diaminopimelate * smiles: ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-succinyl-l,l-2,6-diaminopimelate |
| + | * smiles: | ||
| + | ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** glxuwzbupatpbr-bqbzgakwsa-l | ||
| + | * molecular-weight: | ||
| + | ** 288.257 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}} |
| + | {{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}} | ||
| + | {{#set: molecular-weight=288.257}} | ||
Revision as of 15:27, 5 January 2021
Contents
Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE
- common-name:
- n-succinyl-l,l-2,6-diaminopimelate
- smiles:
- c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
- inchi-key:
- glxuwzbupatpbr-bqbzgakwsa-l
- molecular-weight:
- 288.257
