Difference between revisions of "5-L-GLUTAMYL-AMINO-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3709 == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)...")
(Created page with "Category:metabolite == Metabolite CPD-13684 == * common-name: ** cholest-5-en-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) * inc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3709 ==
+
== Metabolite CPD-13684 ==
 
* common-name:
 
* common-name:
** guanosine 2',3'-cyclic monophosphate
+
** cholest-5-en-3-one
 
* smiles:
 
* smiles:
** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
+
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** uasryodfrywbrc-uuokfmhzsa-m
+
** ggclnoigpmgldb-gykmgiidsa-n
 
* molecular-weight:
 
* molecular-weight:
** 344.2
+
** 384.644
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12058]]
+
* [[RXN-12693]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12693]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=cholest-5-en-3-one}}
{{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}}
+
{{#set: inchi-key=inchikey=ggclnoigpmgldb-gykmgiidsa-n}}
{{#set: molecular-weight=344.2}}
+
{{#set: molecular-weight=384.644}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-13684

  • common-name:
    • cholest-5-en-3-one
  • smiles:
    • cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • ggclnoigpmgldb-gykmgiidsa-n
  • molecular-weight:
    • 384.644

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality