Difference between revisions of "DEOXYADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17385 == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=...")
(Created page with "Category:metabolite == Metabolite CPD-12929 == * common-name: ** 5α-cholesta-7,24-dien-3-one * inchi-key: ** lhhhzzhkuvlcji-iinkennysa-n * molecular-weight: ** 382.6...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17385 ==
+
== Metabolite CPD-12929 ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** 5α-cholesta-7,24-dien-3-one
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
* inchi-key:
 
* inchi-key:
** krifzirxaaithr-kwfbmmabsa-j
+
** lhhhzzhkuvlcji-iinkennysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1102.034
+
** 382.628
 +
* smiles:
 +
** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(ccc(=o)c[c@h](cc=1)2)(c))cc[c@](c)34)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16134]]
+
* [[RXN-21837]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16132]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=5α-cholesta-7,24-dien-3-one}}
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
+
{{#set: inchi-key=inchikey=lhhhzzhkuvlcji-iinkennysa-n}}
{{#set: molecular-weight=1102.034}}
+
{{#set: molecular-weight=382.628}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-12929

  • common-name:
    • 5α-cholesta-7,24-dien-3-one
  • inchi-key:
    • lhhhzzhkuvlcji-iinkennysa-n
  • molecular-weight:
    • 382.628
  • smiles:
    • cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(ccc(=o)c[c@h](cc=1)2)(c))cc[c@](c)34)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality