Difference between revisions of "CPD-474"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSINE5TRIPHOSPHO5ADENOSINE == * common-name: ** 5',5'''-diadenosine triphosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o...")
(Created page with "Category:metabolite == Metabolite CPD-405 == * common-name: ** a phosphatidyl-n-methylethanolamine == Reaction(s) known to consume the compound == * 2.1.1.71-RXN == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSINE5TRIPHOSPHO5ADENOSINE ==
+
== Metabolite CPD-405 ==
 
* common-name:
 
* common-name:
** 5',5'''-diadenosine triphosphate
+
** a phosphatidyl-n-methylethanolamine
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])op(=o)([o-])op(=o)([o-])occ6(c(c(c(n5(c4(=c(c(=nc=n4)n)n=c5)))o6)o)o)
 
* inchi-key:
 
** qcicupzzliqapa-xpwfqurosa-k
 
* molecular-weight:
 
** 753.388
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
+
* [[2.1.1.71-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.1.1.17-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5',5'''-diadenosine triphosphate}}
+
{{#set: common-name=a phosphatidyl-n-methylethanolamine}}
{{#set: inchi-key=inchikey=qcicupzzliqapa-xpwfqurosa-k}}
 
{{#set: molecular-weight=753.388}}
 

Revision as of 15:27, 5 January 2021

Metabolite CPD-405

  • common-name:
    • a phosphatidyl-n-methylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality