Difference between revisions of "CPD-14159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5734-TETRAHYDROXYFLAVONE == * common-name: ** luteolin * smiles: ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite Reduced-flavodoxins == * common-name: ** a reduced flavodoxin == Reaction(s) known to consume the compound == * FLAVONADPREDUCT-RXN *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5734-TETRAHYDROXYFLAVONE ==
+
== Metabolite Reduced-flavodoxins ==
 
* common-name:
 
* common-name:
** luteolin
+
** a reduced flavodoxin
* smiles:
 
** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
 
* inchi-key:
 
** iqpnaansbpbgfq-uhfffaoysa-m
 
* molecular-weight:
 
** 285.232
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FLAVONADPREDUCT-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 +
* [[RXN-15878]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7651]]
+
* [[FLAVONADPREDUCT-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=luteolin}}
+
{{#set: common-name=a reduced flavodoxin}}
{{#set: inchi-key=inchikey=iqpnaansbpbgfq-uhfffaoysa-m}}
 
{{#set: molecular-weight=285.232}}
 

Revision as of 15:27, 5 January 2021

Metabolite Reduced-flavodoxins

  • common-name:
    • a reduced flavodoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality