Difference between revisions of "CPD-17319"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11398 == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(...")
(Created page with "Category:metabolite == Metabolite 1-3-beta-D-Glucans == * common-name: ** a 1,3-β-d-glucan == Reaction(s) known to consume the compound == * 13-BETA-GLUCAN-SYNTHASE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11398 ==
+
== Metabolite 1-3-beta-D-Glucans ==
 
* common-name:
 
* common-name:
** l-thyroxine phenolic β-d-glucuronide
+
** a 1,3-β-d-glucan
* smiles:
 
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
 
* inchi-key:
 
** rghrjbikiyuhev-sgpdefqssa-m
 
* molecular-weight:
 
** 951.992
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[3.2.1.39-RXN]]
 +
* [[3.2.1.58-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10606]]
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[3.2.1.39-RXN]]
 +
* [[3.2.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-thyroxine phenolic β-d-glucuronide}}
+
{{#set: common-name=a 1,3-β-d-glucan}}
{{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}}
 
{{#set: molecular-weight=951.992}}
 

Revision as of 15:27, 5 January 2021

Metabolite 1-3-beta-D-Glucans

  • common-name:
    • a 1,3-β-d-glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality