Difference between revisions of "SULFO-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11521 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(sccnc(=o)ccn...")
(Created page with "Category:metabolite == Metabolite GLYCOGENIN == * common-name: ** a [glycogenin] == Reaction(s) known to consume the compound == * GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11521 ==
+
== Metabolite GLYCOGENIN ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa
+
** a [glycogenin]
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** vwfuyqvgvaevnh-wzglbkmisa-j
 
* molecular-weight:
 
** 1011.867
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10706]]
+
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10699]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa}}
+
{{#set: common-name=a [glycogenin]}}
{{#set: inchi-key=inchikey=vwfuyqvgvaevnh-wzglbkmisa-j}}
 
{{#set: molecular-weight=1011.867}}
 

Revision as of 15:28, 5 January 2021

Metabolite GLYCOGENIN

  • common-name:
    • a [glycogenin]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycogenin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.