Difference between revisions of "GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2105 == * common-name: ** 3-oxododecanoyl-coa * smiles: ** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
(Created page with "Category:metabolite == Metabolite HEPARIN-GLUCOSAMINE == * common-name: ** a [heparan]-α-d-glucosamine == Reaction(s) known to consume the compound == * 2.8.2.30-R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2105 ==
+
== Metabolite HEPARIN-GLUCOSAMINE ==
 
* common-name:
 
* common-name:
** 3-oxododecanoyl-coa
+
** a [heparan]-α-d-glucosamine
* smiles:
 
** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** hqanbzhvwidnqz-gmhmeamdsa-j
 
* molecular-weight:
 
** 959.791
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HACD5]]
+
* [[2.8.2.30-RXN]]
* [[HACD5h]]
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
* [[HACD5m]]
 
* [[RXN-14274]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HACD5]]
 
* [[HACD5h]]
 
* [[HACD5m]]
 
* [[RXN-14274]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxododecanoyl-coa}}
+
{{#set: common-name=a [heparan]-α-d-glucosamine}}
{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
 
{{#set: molecular-weight=959.791}}
 

Revision as of 15:28, 5 January 2021

Metabolite HEPARIN-GLUCOSAMINE

  • common-name:
    • a [heparan]-α-d-glucosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [heparan]-α-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.