Difference between revisions of "5-P-BETA-D-RIBOSYL-AMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCTP == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Phosphatase-2A-leucine == * common-name: ** a [phosphatase 2a protein] c-terminal l-leucine == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Phosphatase-2A-leucine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [phosphatase 2a protein] c-terminal l-leucine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12322]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [phosphatase 2a protein] c-terminal l-leucine}} |
| − | |||
| − | |||
Revision as of 15:29, 5 January 2021
Contents
Metabolite Phosphatase-2A-leucine
- common-name:
- a [phosphatase 2a protein] c-terminal l-leucine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [phosphatase 2a protein] c-terminal l-leucine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
