Difference between revisions of "56-Dihydrouracil47-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3481 == * common-name: ** bupropion * smiles: ** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** snppwiuozrmyny-uhfffaoysa-o *...")
(Created page with "Category:metabolite == Metabolite HOMO-CYS == * common-name: ** l-homocysteine * smiles: ** c(c(ccs)[n+])(=o)[o-] * inchi-key: ** fffhzydwpbmwhy-vkhmyheasa-n * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3481 ==
+
== Metabolite HOMO-CYS ==
 
* common-name:
 
* common-name:
** bupropion
+
** l-homocysteine
 
* smiles:
 
* smiles:
** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1)
+
** c(c(ccs)[n+])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** snppwiuozrmyny-uhfffaoysa-o
+
** fffhzydwpbmwhy-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 240.752
+
** 135.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-181]]
+
* [[2.1.1.5-RXN]]
 +
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 +
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[HOMOCYSMET-RXN]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
 +
* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[MMUM-RXN]]
 +
* [[RXN-15148]]
 +
* [[RXN-9384]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 +
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[HOMOCYSMET-RXN]]
 +
* [[RXN-9384]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=bupropion}}
+
{{#set: common-name=l-homocysteine}}
{{#set: inchi-key=inchikey=snppwiuozrmyny-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=fffhzydwpbmwhy-vkhmyheasa-n}}
{{#set: molecular-weight=240.752}}
+
{{#set: molecular-weight=135.181}}

Revision as of 15:29, 5 January 2021