Difference between revisions of "CA+2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13397 == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o)c)c([o-])=o * inchi-key: ** buqichwnxbibog-lmvfsukvs...") |
(Created page with "Category:metabolite == Metabolite CPD-12932 == * common-name: ** all-trans-3,4-didehydrolycopene * smiles: ** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-12932 == |
* common-name: | * common-name: | ||
− | ** | + | ** all-trans-3,4-didehydrolycopene |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ocmsupsdvxkdfy-fqmrbfjqsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 534.867 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11976]] |
+ | * [[RXN-11999]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12413]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=all-trans-3,4-didehydrolycopene}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ocmsupsdvxkdfy-fqmrbfjqsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=534.867}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite CPD-12932
- common-name:
- all-trans-3,4-didehydrolycopene
- smiles:
- cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
- inchi-key:
- ocmsupsdvxkdfy-fqmrbfjqsa-n
- molecular-weight:
- 534.867